C27H21N3O3 — CID 69301058
N-(5-cyano-2-pyridinyl)-2,3-bis(phenylmethoxy)benzamide (PubChem CID 69301058) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-2,3-bis(phenylmethoxy)benzamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-2,3-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 69301058 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-2,3-bis(phenylmethoxy)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(OCc3ccccc3)c2OCc2ccccc2)nc1 |
| InChI | InChI=1S/C27H21N3O3/c28-16-22-14-15-25(29-17-22)30-27(31)23-12-7-13-24(32-18-20-8-3-1-4-9-20)26(23)33-19-21-10-5-2-6-11-21/h1-15,17H,18-19H2,(H,29,30,31) |
| InChIKey | NFYFZZYIWHSVSO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |