C25H27NO5 — CID 54474953
N-[(2R)-1,4-dihydroxybutan-2-yl]-2,3-bis(phenylmethoxy)benzamide (PubChem CID 54474953) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[(2R)-1,4-dihydroxybutan-2-yl]-2,3-bis(phenylmethoxy)benzamide.
| Compound Name | N-[(2R)-1,4-dihydroxybutan-2-yl]-2,3-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 54474953 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[(2R)-1,4-dihydroxybutan-2-yl]-2,3-bis(phenylmethoxy)benzamide |
| SMILES | O=C(N[C@@H](CO)CCO)c1cccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO5/c27-15-14-21(16-28)26-25(29)22-12-7-13-23(30-17-19-8-3-1-4-9-19)24(22)31-18-20-10-5-2-6-11-20/h1-13,21,27-28H,14-18H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | XKXMUYPWWOLAPP-OAQYLSRUSA-N |
| XLogP | 3.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |