C23H23NO4 — CID 14717390
N-ethyl-N-hydroxy-2,3-bis(phenylmethoxy)benzamide (PubChem CID 14717390) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-ethyl-N-hydroxy-2,3-bis(phenylmethoxy)benzamide.
| Compound Name | N-ethyl-N-hydroxy-2,3-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 14717390 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-ethyl-N-hydroxy-2,3-bis(phenylmethoxy)benzamide |
| SMILES | CCN(O)C(=O)c1cccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c1-2-24(26)23(25)20-14-9-15-21(27-16-18-10-5-3-6-11-18)22(20)28-17-19-12-7-4-8-13-19/h3-15,26H,2,16-17H2,1H3 |
| InChIKey | CQFARTYFKKMGBY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|