C24H24N2O5 — CID 138654400
methyl 2-[2-[2,3-bis(phenylmethoxy)benzoyl]hydrazinyl]acetate (PubChem CID 138654400) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 2-[2-[2,3-bis(phenylmethoxy)benzoyl]hydrazinyl]acetate.
| Compound Name | methyl 2-[2-[2,3-bis(phenylmethoxy)benzoyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 138654400 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl 2-[2-[2,3-bis(phenylmethoxy)benzoyl]hydrazinyl]acetate |
| SMILES | COC(=O)CNNC(=O)c1cccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O5/c1-29-22(27)15-25-26-24(28)20-13-8-14-21(30-16-18-9-4-2-5-10-18)23(20)31-17-19-11-6-3-7-12-19/h2-14,25H,15-17H2,1H3,(H,26,28) |
| InChIKey | VNOFKXNJCRITEW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|