C28H27N3O3 — CID 54362909
N-[(1S)-1,5-dicyanopentyl]-2,3-bis(phenylmethoxy)benzamide (PubChem CID 54362909) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-[(1S)-1,5-dicyanopentyl]-2,3-bis(phenylmethoxy)benzamide.
| Compound Name | N-[(1S)-1,5-dicyanopentyl]-2,3-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 54362909 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[(1S)-1,5-dicyanopentyl]-2,3-bis(phenylmethoxy)benzamide |
| SMILES | N#CCCCC[C@@H](C#N)NC(=O)c1cccc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H27N3O3/c29-18-9-3-8-15-24(19-30)31-28(32)25-16-10-17-26(33-20-22-11-4-1-5-12-22)27(25)34-21-23-13-6-2-7-14-23/h1-2,4-7,10-14,16-17,24H,3,8-9,15,20-21H2,(H,31,32)/t24-/m0/s1 |
| InChIKey | UNTGIXQQUFDBDB-DEOSSOPVSA-N |
| XLogP | 5.55 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|