C18H22ClFN5+ — CID 140790786
[3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-pyrrolidin-1-ylmethanimine (PubChem CID 140790786) has the molecular formula C18H22ClFN5+ and a molecular weight of 362.86 g/mol. Its IUPAC name is [3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-pyrrolidin-1-ylmethanimine.
| Compound Name | [3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-pyrrolidin-1-ylmethanimine |
|---|---|
| PubChem CID | 140790786 |
| Molecular Formula | C18H22ClFN5+ |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-pyrrolidin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1cc(F)c(CN2CCn3c2cc[n+]3C)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C18H22ClFN5/c1-22-7-4-17-24(8-9-25(17)22)12-14-15(19)10-13(11-16(14)20)18(21)23-5-2-3-6-23/h4,7,10-11,21H,2-3,5-6,8-9,12H2,1H3/q+1/b21-18- |
| InChIKey | CDKRPCMTNYRNRR-UZYVYHOESA-N |
| XLogP | 2.55 |
| TPSA | 39.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|