C24H36ClFN4 — CID 145324094
[3-chloro-5-fluoro-4-[[(2E)-2-[(Z)-hex-2-enylidene]imidazolidin-1-yl]methyl]phenyl]-piperidin-1-ylmethanimine;ethane (PubChem CID 145324094) has the molecular formula C24H36ClFN4 and a molecular weight of 435.03 g/mol. Its IUPAC name is [3-chloro-5-fluoro-4-[[(2E)-2-[(Z)-hex-2-enylidene]imidazolidin-1-yl]methyl]phenyl]-piperidin-1-ylmethanimine;ethane.
| Compound Name | [3-chloro-5-fluoro-4-[[(2E)-2-[(Z)-hex-2-enylidene]imidazolidin-1-yl]methyl]phenyl]-piperidin-1-ylmethanimine;ethane |
|---|---|
| PubChem CID | 145324094 |
| Molecular Formula | C24H36ClFN4 |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [3-chloro-5-fluoro-4-[[(2E)-2-[(Z)-hex-2-enylidene]imidazolidin-1-yl]methyl]phenyl]-piperidin-1-ylmethanimine;ethane |
| SMILES | CC.[H]/N=C(/c1cc(F)c(CN2CCN/C2=C\C=C/CCC)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H30ClFN4.C2H6/c1-2-3-4-6-9-21-26-10-13-28(21)16-18-19(23)14-17(15-20(18)24)22(25)27-11-7-5-8-12-27;1-2/h4,6,9,14-15,25-26H,2-3,5,7-8,10-13,16H2,1H3;1-2H3/b6-4-,21-9+,25-22-; |
| InChIKey | WCLYWDDXXGQABU-KICAOKJKSA-N |
| XLogP | 5.92 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|