C17H20ClFN4 — CID 145324142
3-chloro-5-fluoro-4-[[(2E)-3-methyl-2-[(E)-pent-2-enylidene]imidazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 145324142) has the molecular formula C17H20ClFN4 and a molecular weight of 334.83 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-[[(2E)-3-methyl-2-[(E)-pent-2-enylidene]imidazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-5-fluoro-4-[[(2E)-3-methyl-2-[(E)-pent-2-enylidene]imidazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145324142 |
| Molecular Formula | C17H20ClFN4 |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-chloro-5-fluoro-4-[[(2E)-3-methyl-2-[(E)-pent-2-enylidene]imidazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(CN2C=CN(C)/C2=C\C=C\CC)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClFN4/c1-3-4-5-6-16-22(2)7-8-23(16)11-13-14(18)9-12(17(20)21)10-15(13)19/h4-10H,3,11H2,1-2H3,(H3,20,21)/b5-4+,16-6+ |
| InChIKey | DVEVMDCHPRUOAY-TUQJRISCSA-N |
| XLogP | 3.79 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|