C18H22ClFN4 — CID 129239007
3-chloro-5-fluoro-4-[(5-propyl-3,5-dihydro-2H-imidazo[1,2-a]pyridin-1-yl)methyl]benzenecarboximidamide (PubChem CID 129239007) has the molecular formula C18H22ClFN4 and a molecular weight of 348.85 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-[(5-propyl-3,5-dihydro-2H-imidazo[1,2-a]pyridin-1-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-5-fluoro-4-[(5-propyl-3,5-dihydro-2H-imidazo[1,2-a]pyridin-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 129239007 |
| Molecular Formula | C18H22ClFN4 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-chloro-5-fluoro-4-[(5-propyl-3,5-dihydro-2H-imidazo[1,2-a]pyridin-1-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(CN2CCN3C2=CC=CC3CCC)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClFN4/c1-2-4-13-5-3-6-17-23(7-8-24(13)17)11-14-15(19)9-12(18(21)22)10-16(14)20/h3,5-6,9-10,13H,2,4,7-8,11H2,1H3,(H3,21,22) |
| InChIKey | QYCXYLGROQELOV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|