C14H17ClFN5 — CID 145324296
3-chloro-5-fluoro-4-[[(2E)-2-[2-(methylamino)ethylidene]-1H-imidazol-3-yl]methyl]benzenecarboximidamide (PubChem CID 145324296) has the molecular formula C14H17ClFN5 and a molecular weight of 309.78 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-[[(2E)-2-[2-(methylamino)ethylidene]-1H-imidazol-3-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-5-fluoro-4-[[(2E)-2-[2-(methylamino)ethylidene]-1H-imidazol-3-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145324296 |
| Molecular Formula | C14H17ClFN5 |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-chloro-5-fluoro-4-[[(2E)-2-[2-(methylamino)ethylidene]-1H-imidazol-3-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(CN2C=CN/C2=C\CNC)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFN5/c1-19-3-2-13-20-4-5-21(13)8-10-11(15)6-9(14(17)18)7-12(10)16/h2,4-7,19-20H,3,8H2,1H3,(H3,17,18)/b13-2+ |
| InChIKey | ZFSVZTGPIIOIQI-XNJYKOPJSA-N |
| XLogP | 1.70 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|