C10H12F2N2OS — CID 81293387
3,5-difluoro-4-(2-methoxyethylsulfanyl)benzenecarboximidamide (PubChem CID 81293387) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methoxyethylsulfanyl)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-(2-methoxyethylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 81293387 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3,5-difluoro-4-(2-methoxyethylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(SCCOC)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2OS/c1-15-2-3-16-9-7(11)4-6(10(13)14)5-8(9)12/h4-5H,2-3H2,1H3,(H3,13,14) |
| InChIKey | WWSGJMCQXIVMIC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|