C13H17F2N3O — CID 81294570
4-[cyclopropyl(2-methoxyethyl)amino]-3,5-difluorobenzenecarboximidamide (PubChem CID 81294570) has the molecular formula C13H17F2N3O and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-[cyclopropyl(2-methoxyethyl)amino]-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-[cyclopropyl(2-methoxyethyl)amino]-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81294570 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[cyclopropyl(2-methoxyethyl)amino]-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N(CCOC)C2CC2)c(F)c1 |
| InChI | InChI=1S/C13H17F2N3O/c1-19-5-4-18(9-2-3-9)12-10(14)6-8(13(16)17)7-11(12)15/h6-7,9H,2-5H2,1H3,(H3,16,17) |
| InChIKey | COPFLXQEXFASHA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|