C22H27FN4 — CID 129229786
(2E)-2-[(3Z)-3-ethylidene-1-[[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]methyl]pyrrol-2-ylidene]-N-methylethanimine (PubChem CID 129229786) has the molecular formula C22H27FN4 and a molecular weight of 366.48 g/mol. Its IUPAC name is (2E)-2-[(3Z)-3-ethylidene-1-[[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]methyl]pyrrol-2-ylidene]-N-methylethanimine.
| Compound Name | (2E)-2-[(3Z)-3-ethylidene-1-[[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]methyl]pyrrol-2-ylidene]-N-methylethanimine |
|---|---|
| PubChem CID | 129229786 |
| Molecular Formula | C22H27FN4 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2E)-2-[(3Z)-3-ethylidene-1-[[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]methyl]pyrrol-2-ylidene]-N-methylethanimine |
| SMILES | [H]/N=C(/c1ccc(Cn2ccc(=C/C)/c2=C\C=N\C)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H27FN4/c1-3-17-10-14-27(21(17)9-11-25-2)16-19-8-7-18(15-20(19)23)22(24)26-12-5-4-6-13-26/h3,7-11,14-15,24H,4-6,12-13,16H2,1-2H3/b17-3-,21-9+,24-22-,25-11+ |
| InChIKey | KHGHYIBHSWYJAX-JLQHLCCLSA-N |
| XLogP | 2.77 |
| TPSA | 44.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|