C20H23FN5+ — CID 140790915
[3-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine (PubChem CID 140790915) has the molecular formula C20H23FN5+ and a molecular weight of 352.44 g/mol. Its IUPAC name is [3-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine.
| Compound Name | [3-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine |
|---|---|
| PubChem CID | 140790915 |
| Molecular Formula | C20H23FN5+ |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [3-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1ccc(Cn2ccc3c[n+](C)ccc32)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C20H23FN5/c1-24-8-5-19-17(13-24)4-9-26(19)14-16-3-2-15(12-18(16)21)20(22)25-10-6-23-7-11-25/h2-5,8-9,12-13,22-23H,6-7,10-11,14H2,1H3/q+1/b22-20- |
| InChIKey | RONFTWRHLMFXQV-XDOYNYLZSA-N |
| XLogP | 1.88 |
| TPSA | 47.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|