C11H15ClF2N2 — CID 90039977
1-[(2,4-difluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 90039977) has the molecular formula C11H15ClF2N2 and a molecular weight of 248.70 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 90039977 |
| Molecular Formula | C11H15ClF2N2 |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(CN2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2.ClH/c12-10-2-1-9(11(13)7-10)8-15-5-3-14-4-6-15;/h1-2,7,14H,3-6,8H2;1H |
| InChIKey | FUTZACFTEYEBBK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |