C12H17FN2 — CID 22975139
1-[(5-fluoro-2-methylphenyl)methyl]piperazine (PubChem CID 22975139) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylphenyl)methyl]piperazine.
| Compound Name | 1-[(5-fluoro-2-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 22975139 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[(5-fluoro-2-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(F)cc1CN1CCNCC1 |
| InChI | InChI=1S/C12H17FN2/c1-10-2-3-12(13)8-11(10)9-15-6-4-14-5-7-15/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | SJWSFXCZGCZUGO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |