C17H29F2N3 — CID 174896777
N,N-diethylethanamine;1-[(2,4-difluorophenyl)methyl]piperazine (PubChem CID 174896777) has the molecular formula C17H29F2N3 and a molecular weight of 313.44 g/mol. Its IUPAC name is N,N-diethylethanamine;1-[(2,4-difluorophenyl)methyl]piperazine.
| Compound Name | N,N-diethylethanamine;1-[(2,4-difluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 174896777 |
| Molecular Formula | C17H29F2N3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N,N-diethylethanamine;1-[(2,4-difluorophenyl)methyl]piperazine |
| SMILES | CCN(CC)CC.Fc1ccc(CN2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2.C6H15N/c12-10-2-1-9(11(13)7-10)8-15-5-3-14-4-6-15;1-4-7(5-2)6-3/h1-2,7,14H,3-6,8H2;4-6H2,1-3H3 |
| InChIKey | ZDRLVOFONLBELD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |