C12H16F2N2 — CID 763846
1-[(2,4-difluorophenyl)methyl]-4-methylpiperazine (PubChem CID 763846) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 763846 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-methylpiperazine |
| SMILES | CN1CCN(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H16F2N2/c1-15-4-6-16(7-5-15)9-10-2-3-11(13)8-12(10)14/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | JPYWEAHUWCLMEX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |