C12H17FN2S — CID 91656917
4-fluoro-2-[(4-methylpiperazin-1-yl)methyl]benzenethiol (PubChem CID 91656917) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-fluoro-2-[(4-methylpiperazin-1-yl)methyl]benzenethiol.
| Compound Name | 4-fluoro-2-[(4-methylpiperazin-1-yl)methyl]benzenethiol |
|---|---|
| PubChem CID | 91656917 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-fluoro-2-[(4-methylpiperazin-1-yl)methyl]benzenethiol |
| SMILES | CN1CCN(Cc2cc(F)ccc2S)CC1 |
| InChI | InChI=1S/C12H17FN2S/c1-14-4-6-15(7-5-14)9-10-8-11(13)2-3-12(10)16/h2-3,8,16H,4-7,9H2,1H3 |
| InChIKey | JPMVQTQPIOQNER-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|