C14H23FN2 — CID 142195714
ethane;1-[(5-fluoro-2-methylphenyl)methyl]piperazine (PubChem CID 142195714) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is ethane;1-[(5-fluoro-2-methylphenyl)methyl]piperazine.
| Compound Name | ethane;1-[(5-fluoro-2-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 142195714 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | ethane;1-[(5-fluoro-2-methylphenyl)methyl]piperazine |
| SMILES | CC.Cc1ccc(F)cc1CN1CCNCC1 |
| InChI | InChI=1S/C12H17FN2.C2H6/c1-10-2-3-12(13)8-11(10)9-15-6-4-14-5-7-15;1-2/h2-3,8,14H,4-7,9H2,1H3;1-2H3 |
| InChIKey | JCMIUHMRGKMGNZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |