C22H26FN4O+ — CID 159567382
N'-cyclohexyloxy-3-fluoro-4-[(6-methylpyrrolo[2,3-c]pyridin-6-ium-1-yl)methyl]benzenecarboximidamide (PubChem CID 159567382) has the molecular formula C22H26FN4O+ and a molecular weight of 381.48 g/mol. Its IUPAC name is N'-cyclohexyloxy-3-fluoro-4-[(6-methylpyrrolo[2,3-c]pyridin-6-ium-1-yl)methyl]benzenecarboximidamide.
| Compound Name | N'-cyclohexyloxy-3-fluoro-4-[(6-methylpyrrolo[2,3-c]pyridin-6-ium-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 159567382 |
| Molecular Formula | C22H26FN4O+ |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N'-cyclohexyloxy-3-fluoro-4-[(6-methylpyrrolo[2,3-c]pyridin-6-ium-1-yl)methyl]benzenecarboximidamide |
| SMILES | C[n+]1ccc2ccn(Cc3ccc(C(N)=NOC4CCCCC4)cc3F)c2c1 |
| InChI | InChI=1S/C22H26FN4O/c1-26-11-9-16-10-12-27(21(16)15-26)14-18-8-7-17(13-20(18)23)22(24)25-28-19-5-3-2-4-6-19/h7-13,15,19H,2-6,14H2,1H3,(H2,24,25)/q+1 |
| InChIKey | RJLSXBHHLDPWNG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|