C19H24ClFN5O+ — CID 161066596
1-[3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-2-pyrrolidin-3-yloxyethanimine (PubChem CID 161066596) has the molecular formula C19H24ClFN5O+ and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-2-pyrrolidin-3-yloxyethanimine.
| Compound Name | 1-[3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-2-pyrrolidin-3-yloxyethanimine |
|---|---|
| PubChem CID | 161066596 |
| Molecular Formula | C19H24ClFN5O+ |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[3-chloro-5-fluoro-4-[(5-methyl-2,3-dihydroimidazo[1,2-b]pyrazol-5-ium-1-yl)methyl]phenyl]-2-pyrrolidin-3-yloxyethanimine |
| SMILES | [H]/N=C(\COC1CCNC1)c1cc(F)c(CN2CCn3c2cc[n+]3C)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClFN5O/c1-24-5-3-19-25(6-7-26(19)24)11-15-16(20)8-13(9-17(15)21)18(22)12-27-14-2-4-23-10-14/h3,5,8-9,14,22-23H,2,4,6-7,10-12H2,1H3/q+1/b22-18+ |
| InChIKey | QWASZBPRABCPOM-RELWKKBWSA-N |
| XLogP | 1.87 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|