C24H22ClFN2OS — CID 161219303
1-(5-chlorothiophen-2-yl)-3-[2-fluoro-5-[4-(pyrrolidine-1-carboximidoyl)phenyl]phenyl]propan-1-one (PubChem CID 161219303) has the molecular formula C24H22ClFN2OS and a molecular weight of 440.97 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-[2-fluoro-5-[4-(pyrrolidine-1-carboximidoyl)phenyl]phenyl]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-[2-fluoro-5-[4-(pyrrolidine-1-carboximidoyl)phenyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 161219303 |
| Molecular Formula | C24H22ClFN2OS |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-[2-fluoro-5-[4-(pyrrolidine-1-carboximidoyl)phenyl]phenyl]propan-1-one |
| SMILES | [H]/N=C(/c1ccc(-c2ccc(F)c(CCC(=O)c3ccc(Cl)s3)c2)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H22ClFN2OS/c25-23-12-11-22(30-23)21(29)10-8-19-15-18(7-9-20(19)26)16-3-5-17(6-4-16)24(27)28-13-1-2-14-28/h3-7,9,11-12,15,27H,1-2,8,10,13-14H2/b27-24- |
| InChIKey | UXHHAVAXSZGVHV-PNHLSOANSA-N |
| XLogP | 6.44 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|