C24H19ClF3N5O — CID 21366656
1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 21366656) has the molecular formula C24H19ClF3N5O and a molecular weight of 485.90 g/mol. Its IUPAC name is 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366656 |
| Molecular Formula | C24H19ClF3N5O |
| Molecular Weight | 485.90 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-(6-chloronaphthalen-2-yl)-N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C(F)(F)F)nn2-c2ccc3cc(Cl)ccc3c2)cc1)N(C)C |
| InChI | InChI=1S/C24H19ClF3N5O/c1-32(2)22(29)14-4-8-18(9-5-14)30-23(34)20-13-21(24(26,27)28)31-33(20)19-10-6-15-11-17(25)7-3-16(15)12-19/h3-13,29H,1-2H3,(H,30,34)/b29-22- |
| InChIKey | CQRAJMUDDRMITJ-IADYIPOJSA-N |
| XLogP | 5.84 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.90 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|