C18H17N — CID 144968069
(2Z)-1-(3-methyl-5-phenylphenyl)penta-2,4-dien-1-imine (PubChem CID 144968069) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is (2Z)-1-(3-methyl-5-phenylphenyl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-(3-methyl-5-phenylphenyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144968069 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2Z)-1-(3-methyl-5-phenylphenyl)penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)c1cc(C)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H17N/c1-3-4-10-18(19)17-12-14(2)11-16(13-17)15-8-6-5-7-9-15/h3-13,19H,1H2,2H3/b10-4-,19-18+ |
| InChIKey | PYNHLIMDLZCCFL-YRSKDIJWSA-N |
| XLogP | 4.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|