C31H28 — CID 145272446
1-[(3E,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]-3-methyl-5-phenylbenzene (PubChem CID 145272446) has the molecular formula C31H28 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[(3E,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]-3-methyl-5-phenylbenzene.
| Compound Name | 1-[(3E,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]-3-methyl-5-phenylbenzene |
|---|---|
| PubChem CID | 145272446 |
| Molecular Formula | C31H28 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[(3E,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]-3-methyl-5-phenylbenzene |
| SMILES | C=C/C=C\C(=C)C(=C)/C(=C(\C=C)c1ccccc1)c1cc(C)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C31H28/c1-6-8-15-24(4)25(5)31(30(7-2)27-18-13-10-14-19-27)29-21-23(3)20-28(22-29)26-16-11-9-12-17-26/h6-22H,1-2,4-5H2,3H3/b15-8-,31-30- |
| InChIKey | SXQIPHBEXSOBKH-IKOPCPLNSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|