C26H32O2S — CID 122415338
S-[2-[(3Z,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]oxyethyl] 2,2-dimethylbutanethioate (PubChem CID 122415338) has the molecular formula C26H32O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is S-[2-[(3Z,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]oxyethyl] 2,2-dimethylbutanethioate.
| Compound Name | S-[2-[(3Z,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]oxyethyl] 2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 122415338 |
| Molecular Formula | C26H32O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | S-[2-[(3Z,7Z)-5,6-dimethylidene-3-phenyldeca-1,3,7,9-tetraen-4-yl]oxyethyl] 2,2-dimethylbutanethioate |
| SMILES | C=C/C=C\C(=C)C(=C)/C(OCCSC(=O)C(C)(C)CC)=C(\C=C)c1ccccc1 |
| InChI | InChI=1S/C26H32O2S/c1-8-11-15-20(4)21(5)24(23(9-2)22-16-13-12-14-17-22)28-18-19-29-25(27)26(6,7)10-3/h8-9,11-17H,1-2,4-5,10,18-19H2,3,6-7H3/b15-11-,24-23- |
| InChIKey | RAVFCSBIZWJYSO-ISMJYASLSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|