C16H24N2O5 — CID 58946993
2-[1-[(E)-hydroperoxydiazenyl]-1-phenylethoxy]ethyl 2,2-dimethylbutanoate (PubChem CID 58946993) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[1-[(E)-hydroperoxydiazenyl]-1-phenylethoxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[1-[(E)-hydroperoxydiazenyl]-1-phenylethoxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58946993 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[1-[(E)-hydroperoxydiazenyl]-1-phenylethoxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(C)(/N=N/OO)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O5/c1-5-15(2,3)14(19)21-11-12-22-16(4,17-18-23-20)13-9-7-6-8-10-13/h6-10,20H,5,11-12H2,1-4H3/b18-17+ |
| InChIKey | QBPFQZOIAHUDGG-ISLYRVAYSA-N |
| XLogP | 3.71 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|