C42H35N — CID 145117444
4-[(3E,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-yl]-N,3-diphenyl-N-(4-phenylphenyl)aniline (PubChem CID 145117444) has the molecular formula C42H35N and a molecular weight of 553.75 g/mol. Its IUPAC name is 4-[(3E,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-yl]-N,3-diphenyl-N-(4-phenylphenyl)aniline.
| Compound Name | 4-[(3E,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-yl]-N,3-diphenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 145117444 |
| Molecular Formula | C42H35N |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 4-[(3E,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-yl]-N,3-diphenyl-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C\C(=C)C(=C)/C(=C\C=C)c1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C42H35N/c1-5-7-18-32(3)33(4)40(17-6-2)41-30-29-39(31-42(41)36-21-13-9-14-22-36)43(37-23-15-10-16-24-37)38-27-25-35(26-28-38)34-19-11-8-12-20-34/h5-31H,1-4H2/b18-7-,40-17+ |
| InChIKey | BVBJQTVJKXXGBK-SZTWSBNHSA-N |
| XLogP | 11.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|