C61H47N — CID 134320776
N-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-phenylphenyl)phenyl]-3-phenyl-N,4-bis(4-phenylphenyl)aniline (PubChem CID 134320776) has the molecular formula C61H47N and a molecular weight of 794.05 g/mol. Its IUPAC name is N-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-phenylphenyl)phenyl]-3-phenyl-N,4-bis(4-phenylphenyl)aniline.
| Compound Name | N-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-phenylphenyl)phenyl]-3-phenyl-N,4-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 134320776 |
| Molecular Formula | C61H47N |
| Molecular Weight | 794.05 g/mol |
| Exact Mass | 793.37 |
| IUPAC Name | N-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-phenylphenyl)phenyl]-3-phenyl-N,4-bis(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C/C)c1cc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(-c4ccccc4)cc3)c(-c3ccccc3)c2)ccc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C61H47N/c1-3-17-51(18-4-2)60-43-56(39-41-58(60)53-31-27-48(28-32-53)45-19-9-5-10-20-45)62(55-37-35-50(36-38-55)47-23-13-7-14-24-47)57-40-42-59(61(44-57)52-25-15-8-16-26-52)54-33-29-49(30-34-54)46-21-11-6-12-22-46/h3-44H,1H2,2H3/b18-4-,51-17+ |
| InChIKey | DRPZILAUAJXGAF-VEWYWQGNSA-N |
| XLogP | 17.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.05 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|