C39H41NO — CID 145470212
ethane;3-[(2E)-2-ethenylpenta-2,4-dienoxy]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-(4-phenylphenyl)aniline (PubChem CID 145470212) has the molecular formula C39H41NO and a molecular weight of 539.76 g/mol. Its IUPAC name is ethane;3-[(2E)-2-ethenylpenta-2,4-dienoxy]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-(4-phenylphenyl)aniline.
| Compound Name | ethane;3-[(2E)-2-ethenylpenta-2,4-dienoxy]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 145470212 |
| Molecular Formula | C39H41NO |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | ethane;3-[(2E)-2-ethenylpenta-2,4-dienoxy]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C)COc1cccc(N(c2ccc(C(/C=C\C)=C/C)cc2)c2ccc(-c3ccccc3)cc2)c1.CC |
| InChI | InChI=1S/C37H35NO.C2H6/c1-5-13-29(7-3)28-39-37-18-12-17-36(27-37)38(34-23-19-32(20-24-34)30(8-4)14-6-2)35-25-21-33(22-26-35)31-15-10-9-11-16-31;1-2/h5-27H,1,3,28H2,2,4H3;1-2H3/b14-6-,29-13+,30-8+; |
| InChIKey | NOVXTWVLLUSDPB-WXMRFNKISA-N |
| XLogP | 11.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|