C55H47N — CID 142540856
4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-phenyl-N-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]aniline (PubChem CID 142540856) has the molecular formula C55H47N and a molecular weight of 721.99 g/mol. Its IUPAC name is 4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-phenyl-N-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]aniline.
| Compound Name | 4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-phenyl-N-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 142540856 |
| Molecular Formula | C55H47N |
| Molecular Weight | 721.99 g/mol |
| Exact Mass | 721.37 |
| IUPAC Name | 4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-phenyl-N-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]aniline |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc5c(c4)-c4cc6c(cc4C5(C)C)-c4ccccc4C6(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H47N/c1-7-14-37(15-8-2)38-20-22-39(23-21-38)40-24-29-44(30-25-40)56(43-16-10-9-11-17-43)45-31-26-41(27-32-45)42-28-33-51-47(34-42)49-36-52-48(35-53(49)55(51,5)6)46-18-12-13-19-50(46)54(52,3)4/h7-36H,1H2,2-6H3/b15-8-,37-14+ |
| InChIKey | JBDQLNRIPRJBAI-RDCLKSQYSA-N |
| XLogP | 15.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.99 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|