C37H34 — CID 143467691
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6,6,12,12-tetramethyl-8-phenylindeno[1,2-b]fluorene (PubChem CID 143467691) has the molecular formula C37H34 and a molecular weight of 478.68 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6,6,12,12-tetramethyl-8-phenylindeno[1,2-b]fluorene.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6,6,12,12-tetramethyl-8-phenylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 143467691 |
| Molecular Formula | C37H34 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6,6,12,12-tetramethyl-8-phenylindeno[1,2-b]fluorene |
| SMILES | C=C/C=C(\C=C/C)c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1cc(-c2ccccc2)ccc1-3 |
| InChI | InChI=1S/C37H34/c1-7-12-24(13-8-2)26-16-18-28-30-22-35-31(23-34(30)36(3,4)32(28)20-26)29-19-17-27(21-33(29)37(35,5)6)25-14-10-9-11-15-25/h7-23H,1H2,2-6H3/b13-8-,24-12+ |
| InChIKey | VKCJYJPDWRSBGW-GMFBGQLQSA-N |
| XLogP | 10.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|