C62H49N — CID 145298642
9,9-dimethyl-7-naphthalen-1-yl-N-[(2Z,4E)-4-(4-phenylphenyl)hepta-2,4,6-trienyl]-N-[4-(4-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 145298642) has the molecular formula C62H49N and a molecular weight of 808.08 g/mol. Its IUPAC name is 9,9-dimethyl-7-naphthalen-1-yl-N-[(2Z,4E)-4-(4-phenylphenyl)hepta-2,4,6-trienyl]-N-[4-(4-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-7-naphthalen-1-yl-N-[(2Z,4E)-4-(4-phenylphenyl)hepta-2,4,6-trienyl]-N-[4-(4-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 145298642 |
| Molecular Formula | C62H49N |
| Molecular Weight | 808.08 g/mol |
| Exact Mass | 807.39 |
| IUPAC Name | 9,9-dimethyl-7-naphthalen-1-yl-N-[(2Z,4E)-4-(4-phenylphenyl)hepta-2,4,6-trienyl]-N-[4-(4-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | C=C/C=C(\C=C/CN(c1ccc(-c2ccc(-c3ccccc3)cc2)cc1)c1ccc2c(c1)C(C)(C)c1cc(-c3cccc4ccccc34)ccc1-2)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C62H49N/c1-4-15-44(47-25-27-48(28-26-47)45-16-7-5-8-17-45)22-14-41-63(54-36-33-51(34-37-54)50-31-29-49(30-32-50)46-18-9-6-10-19-46)55-38-40-59-58-39-35-53(42-60(58)62(2,3)61(59)43-55)57-24-13-21-52-20-11-12-23-56(52)57/h4-40,42-43H,1,41H2,2-3H3/b22-14-,44-15+ |
| InChIKey | PQGGREIWIYBSSE-FENSZSLESA-N |
| XLogP | 16.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.08 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|