C43H38 — CID 145474559
2-[(2Z,4E)-4-(9,9-dimethylfluoren-2-yl)hepta-2,4,6-trienyl]-9,9-dimethyl-7-phenylfluorene (PubChem CID 145474559) has the molecular formula C43H38 and a molecular weight of 554.78 g/mol. Its IUPAC name is 2-[(2Z,4E)-4-(9,9-dimethylfluoren-2-yl)hepta-2,4,6-trienyl]-9,9-dimethyl-7-phenylfluorene.
| Compound Name | 2-[(2Z,4E)-4-(9,9-dimethylfluoren-2-yl)hepta-2,4,6-trienyl]-9,9-dimethyl-7-phenylfluorene |
|---|---|
| PubChem CID | 145474559 |
| Molecular Formula | C43H38 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 2-[(2Z,4E)-4-(9,9-dimethylfluoren-2-yl)hepta-2,4,6-trienyl]-9,9-dimethyl-7-phenylfluorene |
| SMILES | C=C/C=C(\C=C/Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccccc3)ccc1-2)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C43H38/c1-6-13-30(32-21-24-36-34-18-10-11-19-38(34)42(2,3)40(36)27-32)17-12-14-29-20-23-35-37-25-22-33(31-15-8-7-9-16-31)28-41(37)43(4,5)39(35)26-29/h6-13,15-28H,1,14H2,2-5H3/b17-12-,30-13+ |
| InChIKey | CALNJXPZYURIBO-OWQIMCBISA-N |
| XLogP | 11.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|