C42H38 — CID 123148254
2-[4-(9,9-dimethylfluoren-2-yl)phenyl]-7-hexa-1,4-dien-2-yl-9,9-dimethylfluorene (PubChem CID 123148254) has the molecular formula C42H38 and a molecular weight of 542.77 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylfluoren-2-yl)phenyl]-7-hexa-1,4-dien-2-yl-9,9-dimethylfluorene.
| Compound Name | 2-[4-(9,9-dimethylfluoren-2-yl)phenyl]-7-hexa-1,4-dien-2-yl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 123148254 |
| Molecular Formula | C42H38 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 2-[4-(9,9-dimethylfluoren-2-yl)phenyl]-7-hexa-1,4-dien-2-yl-9,9-dimethylfluorene |
| SMILES | C=C(CC=CC)c1ccc2c(c1)C(C)(C)c1cc(-c3ccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)ccc1-2 |
| InChI | InChI=1S/C42H38/c1-7-8-11-27(2)30-18-21-35-36-23-20-32(26-40(36)42(5,6)38(35)24-30)29-16-14-28(15-17-29)31-19-22-34-33-12-9-10-13-37(33)41(3,4)39(34)25-31/h7-10,12-26H,2,11H2,1,3-6H3 |
| InChIKey | MSNGEPRMHKRNLO-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|