C55H42 — CID 145493781
9-(2,4-diphenylphenyl)-2,3-bis(ethenyl)-10-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylphenyl]anthracene (PubChem CID 145493781) has the molecular formula C55H42 and a molecular weight of 702.94 g/mol. Its IUPAC name is 9-(2,4-diphenylphenyl)-2,3-bis(ethenyl)-10-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylphenyl]anthracene.
| Compound Name | 9-(2,4-diphenylphenyl)-2,3-bis(ethenyl)-10-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylphenyl]anthracene |
|---|---|
| PubChem CID | 145493781 |
| Molecular Formula | C55H42 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | 9-(2,4-diphenylphenyl)-2,3-bis(ethenyl)-10-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylphenyl]anthracene |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2c3ccccc3c(-c3ccc(-c4ccccc4)cc3-c3ccccc3)c3cc(C=C)c(C=C)cc23)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C55H42/c1-5-20-40(21-6-2)44-30-32-48(50(36-44)42-24-14-10-15-25-42)54-46-28-18-19-29-47(46)55(53-35-39(8-4)38(7-3)34-52(53)54)49-33-31-45(41-22-12-9-13-23-41)37-51(49)43-26-16-11-17-27-43/h5-37H,1,3-4H2,2H3/b21-6-,40-20+ |
| InChIKey | YUNJMYAAYKGRQB-LXIWRCFWSA-N |
| XLogP | 15.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|