C19H17N — CID 167223078
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9H-carbazole (PubChem CID 167223078) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9H-carbazole.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9H-carbazole |
|---|---|
| PubChem CID | 167223078 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9H-carbazole |
| SMILES | C=C/C=C(\C=C/C)c1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C19H17N/c1-3-7-14(8-4-2)15-11-12-19-17(13-15)16-9-5-6-10-18(16)20-19/h3-13,20H,1H2,2H3/b8-4-,14-7+ |
| InChIKey | CDECBNOUQGRKOE-PVJUNDMFSA-N |
| XLogP | 5.47 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|