C26H20N2 — CID 129162620
5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene (PubChem CID 129162620) has the molecular formula C26H20N2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 129162620 |
| Molecular Formula | C26H20N2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaene |
| SMILES | C=C/C=C(\C=C/C)c1ccc2c(c1)c1ccccc1n1c3ccccc3nc21 |
| InChI | InChI=1S/C26H20N2/c1-3-9-18(10-4-2)19-15-16-21-22(17-19)20-11-5-7-13-24(20)28-25-14-8-6-12-23(25)27-26(21)28/h3-17H,1H2,2H3/b10-4-,18-9+ |
| InChIKey | XFIQCORKYHSWIN-WPAOCOIMSA-N |
| XLogP | 6.94 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|