C49H36N4 — CID 88861153
6-(14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-5-yl)-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]-N-(4-phenylphenyl)pyridin-2-amine (PubChem CID 88861153) has the molecular formula C49H36N4 and a molecular weight of 680.86 g/mol. Its IUPAC name is 6-(14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-5-yl)-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]-N-(4-phenylphenyl)pyridin-2-amine.
| Compound Name | 6-(14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-5-yl)-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]-N-(4-phenylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 88861153 |
| Molecular Formula | C49H36N4 |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | 6-(14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-5-yl)-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]-N-(4-phenylphenyl)pyridin-2-amine |
| SMILES | C=C(/C=C\C(=C/C)c1ccccc1)N(c1ccc(-c2ccccc2)cc1)c1cccc(-c2ccc3c(c2)c2ccccc2n2c4ccccc4nc32)n1 |
| InChI | InChI=1S/C49H36N4/c1-3-35(36-15-6-4-7-16-36)26-25-34(2)52(40-30-27-38(28-31-40)37-17-8-5-9-18-37)48-24-14-21-44(50-48)39-29-32-42-43(33-39)41-19-10-12-22-46(41)53-47-23-13-11-20-45(47)51-49(42)53/h3-33H,2H2,1H3/b26-25-,35-3+ |
| InChIKey | RBSBIYYXOGMHNM-XPZHEJOJSA-N |
| XLogP | 12.83 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|