C50H43N — CID 134194377
N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylphenyl]-1,2-dihydrophenanthren-9-amine (PubChem CID 134194377) has the molecular formula C50H43N and a molecular weight of 657.90 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylphenyl]-1,2-dihydrophenanthren-9-amine.
| Compound Name | N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylphenyl]-1,2-dihydrophenanthren-9-amine |
|---|---|
| PubChem CID | 134194377 |
| Molecular Formula | C50H43N |
| Molecular Weight | 657.90 g/mol |
| Exact Mass | 657.34 |
| IUPAC Name | N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylphenyl]-1,2-dihydrophenanthren-9-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(-c2ccc(N(c3ccc(C(/C=C\C)=C/C)cc3)c3cc4c(c5ccccc35)C=CCC4)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C50H43N/c1-5-16-36(7-3)38-24-26-41(27-25-38)46-33-32-44(35-49(46)40-18-10-9-11-19-40)51(43-30-28-39(29-31-43)37(8-4)17-6-2)50-34-42-20-12-13-21-45(42)47-22-14-15-23-48(47)50/h5-11,13-19,21-35H,1,3,12,20H2,2,4H3/b17-6-,36-16+,37-8+ |
| InChIKey | RMFIPEMABSBANE-FWUQCICRSA-N |
| XLogP | 14.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.90 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|