C49H39N — CID 134219934
2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylphenyl]-N,N-bis(3-phenylphenyl)aniline (PubChem CID 134219934) has the molecular formula C49H39N and a molecular weight of 641.86 g/mol. Its IUPAC name is 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylphenyl]-N,N-bis(3-phenylphenyl)aniline.
| Compound Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylphenyl]-N,N-bis(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 134219934 |
| Molecular Formula | C49H39N |
| Molecular Weight | 641.86 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylphenyl]-N,N-bis(3-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2ccccc2N(c2cccc(-c3ccccc3)c2)c2cccc(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C49H39N/c1-3-18-39(19-4-2)46-33-32-43(36-48(46)40-24-12-7-13-25-40)47-30-14-15-31-49(47)50(44-28-16-26-41(34-44)37-20-8-5-9-21-37)45-29-17-27-42(35-45)38-22-10-6-11-23-38/h3-36H,1H2,2H3/b19-4-,39-18+ |
| InChIKey | YTAAFZYLLOJDFY-HVHHHHAJSA-N |
| XLogP | 13.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.86 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|