C37H31NO — CID 137396906
[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]-phenylmethanone (PubChem CID 137396906) has the molecular formula C37H31NO and a molecular weight of 505.66 g/mol. Its IUPAC name is [3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]-phenylmethanone.
| Compound Name | [3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 137396906 |
| Molecular Formula | C37H31NO |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]-phenylmethanone |
| SMILES | C/C=C\C(=C/C)c1ccc(N(c2cccc(C(=O)c3ccccc3)c2)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H31NO/c1-3-14-28(4-2)29-23-25-33(26-24-29)38(36-22-12-11-21-35(36)30-15-7-5-8-16-30)34-20-13-19-32(27-34)37(39)31-17-9-6-10-18-31/h3-27H,1-2H3/b14-3-,28-4+ |
| InChIKey | PZIUJXYQFSJFBG-OXFJJTMGSA-N |
| XLogP | 10.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|