C36H32N2 — CID 123184423
N-[3-(C-but-1-enyl-N-methylcarbonimidoyl)phenyl]-2-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 123184423) has the molecular formula C36H32N2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-[3-(C-but-1-enyl-N-methylcarbonimidoyl)phenyl]-2-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-[3-(C-but-1-enyl-N-methylcarbonimidoyl)phenyl]-2-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 123184423 |
| Molecular Formula | C36H32N2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-[3-(C-but-1-enyl-N-methylcarbonimidoyl)phenyl]-2-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | CCC=C/C(=N\C)c1cccc(N(c2ccc(-c3ccccc3)cc2)c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C36H32N2/c1-3-4-21-35(37-2)31-18-13-19-33(27-31)38(32-25-23-29(24-26-32)28-14-7-5-8-15-28)36-22-12-11-20-34(36)30-16-9-6-10-17-30/h4-27H,3H2,1-2H3/b21-4?,37-35+ |
| InChIKey | ZDPRSUOIGMWCIJ-ZRDIIJSPSA-N |
| XLogP | 9.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|