C57H51NO4 — CID 167199807
diethyl 2-[2-[4-[N-(9,9-dimethylfluoren-2-yl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]-5-phenylbenzene-1,4-dicarboxylate (PubChem CID 167199807) has the molecular formula C57H51NO4 and a molecular weight of 814.04 g/mol. Its IUPAC name is diethyl 2-[2-[4-[N-(9,9-dimethylfluoren-2-yl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]-5-phenylbenzene-1,4-dicarboxylate.
| Compound Name | diethyl 2-[2-[4-[N-(9,9-dimethylfluoren-2-yl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]-5-phenylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 167199807 |
| Molecular Formula | C57H51NO4 |
| Molecular Weight | 814.04 g/mol |
| Exact Mass | 813.38 |
| IUPAC Name | diethyl 2-[2-[4-[N-(9,9-dimethylfluoren-2-yl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]-5-phenylbenzene-1,4-dicarboxylate |
| SMILES | C/C=C\C(=C/C)c1ccc(N(c2ccc(-c3ccccc3-c3cc(C(=O)OCC)c(-c4ccccc4)cc3C(=O)OCC)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C57H51NO4/c1-7-18-38(8-2)39-25-29-42(30-26-39)58(44-33-34-48-47-23-16-17-24-53(47)57(5,6)54(48)35-44)43-31-27-41(28-32-43)45-21-14-15-22-46(45)50-37-51(55(59)61-9-3)49(40-19-12-11-13-20-40)36-52(50)56(60)62-10-4/h7-8,11-37H,9-10H2,1-6H3/b18-7-,38-8+ |
| InChIKey | BQJANOXILYCDBJ-IGIMZTCJSA-N |
| XLogP | 14.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.04 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|