C57H47N — CID 146631311
4-[(2Z,4Z)-2-(9,9-dimethylfluoren-2-yl)hexa-2,4-dien-3-yl]-3-phenyl-N,N-bis(4-phenylphenyl)aniline (PubChem CID 146631311) has the molecular formula C57H47N and a molecular weight of 746.01 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-(9,9-dimethylfluoren-2-yl)hexa-2,4-dien-3-yl]-3-phenyl-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 4-[(2Z,4Z)-2-(9,9-dimethylfluoren-2-yl)hexa-2,4-dien-3-yl]-3-phenyl-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 146631311 |
| Molecular Formula | C57H47N |
| Molecular Weight | 746.01 g/mol |
| Exact Mass | 745.37 |
| IUPAC Name | 4-[(2Z,4Z)-2-(9,9-dimethylfluoren-2-yl)hexa-2,4-dien-3-yl]-3-phenyl-N,N-bis(4-phenylphenyl)aniline |
| SMILES | C/C=C\C(=C(/C)c1ccc2c(c1)C(C)(C)c1ccccc1-2)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C57H47N/c1-5-17-50(40(2)46-30-36-53-52-24-15-16-25-55(52)57(3,4)56(53)38-46)51-37-35-49(39-54(51)45-22-13-8-14-23-45)58(47-31-26-43(27-32-47)41-18-9-6-10-19-41)48-33-28-44(29-34-48)42-20-11-7-12-21-42/h5-39H,1-4H3/b17-5-,50-40- |
| InChIKey | AUINDEJVNAUHAW-WFAKENCXSA-N |
| XLogP | 15.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.01 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|