C36H25Br2N — CID 153293994
N,N-bis(4-bromophenyl)-3-phenyl-4-(4-phenylphenyl)aniline (PubChem CID 153293994) has the molecular formula C36H25Br2N and a molecular weight of 631.41 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-3-phenyl-4-(4-phenylphenyl)aniline.
| Compound Name | N,N-bis(4-bromophenyl)-3-phenyl-4-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 153293994 |
| Molecular Formula | C36H25Br2N |
| Molecular Weight | 631.41 g/mol |
| Exact Mass | 629.04 |
| IUPAC Name | N,N-bis(4-bromophenyl)-3-phenyl-4-(4-phenylphenyl)aniline |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2)c2ccc(-c3ccc(-c4ccccc4)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H25Br2N/c37-30-15-19-32(20-16-30)39(33-21-17-31(38)18-22-33)34-23-24-35(36(25-34)28-9-5-2-6-10-28)29-13-11-27(12-14-29)26-7-3-1-4-8-26/h1-25H |
| InChIKey | WCAARXLJNCUDKD-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.41 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |