C57H45NO — CID 145077386
N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methoxyphenyl]phenyl]-9,9-diphenyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 145077386) has the molecular formula C57H45NO and a molecular weight of 759.99 g/mol. Its IUPAC name is N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methoxyphenyl]phenyl]-9,9-diphenyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methoxyphenyl]phenyl]-9,9-diphenyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 145077386 |
| Molecular Formula | C57H45NO |
| Molecular Weight | 759.99 g/mol |
| Exact Mass | 759.35 |
| IUPAC Name | N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methoxyphenyl]phenyl]-9,9-diphenyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc2)ccc1OC |
| InChI | InChI=1S/C57H45NO/c1-4-17-44(18-5-2)53-39-45(31-38-56(53)59-3)43-29-34-49(35-30-43)58(48-32-27-42(28-33-48)41-19-9-6-10-20-41)50-36-37-52-51-25-15-16-26-54(51)57(55(52)40-50,46-21-11-7-12-22-46)47-23-13-8-14-24-47/h4-40H,1H2,2-3H3/b18-5-,44-17+ |
| InChIKey | UXSRHUYDIUOEIX-DPUPILMJSA-N |
| XLogP | 15.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.99 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|