C26H32O2 — CID 144619668
(2E,3Z)-1-(3-benzoyl-5-methylphenyl)-2-ethylidenehexa-3,5-dien-1-one;ethane (PubChem CID 144619668) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (2E,3Z)-1-(3-benzoyl-5-methylphenyl)-2-ethylidenehexa-3,5-dien-1-one;ethane.
| Compound Name | (2E,3Z)-1-(3-benzoyl-5-methylphenyl)-2-ethylidenehexa-3,5-dien-1-one;ethane |
|---|---|
| PubChem CID | 144619668 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (2E,3Z)-1-(3-benzoyl-5-methylphenyl)-2-ethylidenehexa-3,5-dien-1-one;ethane |
| SMILES | C=C/C=C\C(=C/C)C(=O)c1cc(C)cc(C(=O)c2ccccc2)c1.CC.CC |
| InChI | InChI=1S/C22H20O2.2C2H6/c1-4-6-10-17(5-2)21(23)19-13-16(3)14-20(15-19)22(24)18-11-8-7-9-12-18;2*1-2/h4-15H,1H2,2-3H3;2*1-2H3/b10-6-,17-5+;; |
| InChIKey | VDPFNPWNNUJOFD-IZAXAEJDSA-N |
| XLogP | 7.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|