C17H22O — CID 143624679
ethane;(2E,3Z,5Z)-2-ethylidene-1-phenylhepta-3,5-dien-1-one (PubChem CID 143624679) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;(2E,3Z,5Z)-2-ethylidene-1-phenylhepta-3,5-dien-1-one.
| Compound Name | ethane;(2E,3Z,5Z)-2-ethylidene-1-phenylhepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 143624679 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | ethane;(2E,3Z,5Z)-2-ethylidene-1-phenylhepta-3,5-dien-1-one |
| SMILES | C/C=C\C=C/C(=C\C)C(=O)c1ccccc1.CC |
| InChI | InChI=1S/C15H16O.C2H6/c1-3-5-7-10-13(4-2)15(16)14-11-8-6-9-12-14;1-2/h3-12H,1-2H3;1-2H3/b5-3-,10-7-,13-4+; |
| InChIKey | GMQOSHQUYYFUHZ-QMWBMLPWSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|